C12H19N3S2 — CID 81053938
2,6-dimethyl-4-(3-methylsulfanylpropylamino)pyridine-3-carbothioamide (PubChem CID 81053938) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-methylsulfanylpropylamino)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(3-methylsulfanylpropylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81053938 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2,6-dimethyl-4-(3-methylsulfanylpropylamino)pyridine-3-carbothioamide |
| SMILES | CSCCCNc1cc(C)nc(C)c1C(N)=S |
| InChI | InChI=1S/C12H19N3S2/c1-8-7-10(14-5-4-6-17-3)11(12(13)16)9(2)15-8/h7H,4-6H2,1-3H3,(H2,13,16)(H,14,15) |
| InChIKey | GLOUTRNBSIXPEQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|