C14H18N4OS — CID 106372577
4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 106372577) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 106372577 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(NCc2nc(C)c(C)o2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-7-5-11(13(14(15)20)9(3)17-7)16-6-12-18-8(2)10(4)19-12/h5H,6H2,1-4H3,(H2,15,20)(H,16,17) |
| InChIKey | JDHRUWCMLUBCEI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|