C13H15N5S — CID 106896306
2,6-dimethyl-4-(pyridazin-3-ylmethylamino)pyridine-3-carbothioamide (PubChem CID 106896306) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-(pyridazin-3-ylmethylamino)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(pyridazin-3-ylmethylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 106896306 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2,6-dimethyl-4-(pyridazin-3-ylmethylamino)pyridine-3-carbothioamide |
| SMILES | Cc1cc(NCc2cccnn2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C13H15N5S/c1-8-6-11(12(13(14)19)9(2)17-8)15-7-10-4-3-5-16-18-10/h3-6H,7H2,1-2H3,(H2,14,19)(H,15,17) |
| InChIKey | IUHKONKEGBUBGI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|