C13H12FN3S — CID 63672661
5-fluoro-2-(pyridin-3-ylmethylamino)benzenecarbothioamide (PubChem CID 63672661) has the molecular formula C13H12FN3S and a molecular weight of 261.33 g/mol. Its IUPAC name is 5-fluoro-2-(pyridin-3-ylmethylamino)benzenecarbothioamide.
| Compound Name | 5-fluoro-2-(pyridin-3-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63672661 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-fluoro-2-(pyridin-3-ylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1NCc1cccnc1 |
| InChI | InChI=1S/C13H12FN3S/c14-10-3-4-12(11(6-10)13(15)18)17-8-9-2-1-5-16-7-9/h1-7,17H,8H2,(H2,15,18) |
| InChIKey | UMKXDPIHMHTRMZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|