C12H12FN3S2 — CID 55232902
5-fluoro-2-[2-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide (PubChem CID 55232902) has the molecular formula C12H12FN3S2 and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-fluoro-2-[2-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[2-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55232902 |
| Molecular Formula | C12H12FN3S2 |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-fluoro-2-[2-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1NCCc1nccs1 |
| InChI | InChI=1S/C12H12FN3S2/c13-8-1-2-10(9(7-8)12(14)17)15-4-3-11-16-5-6-18-11/h1-2,5-7,15H,3-4H2,(H2,14,17) |
| InChIKey | DYFNBRPAVHPXCU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|