C13H18N4S2 — CID 55242496
1,3-dimethyl-5-[1-(5-methylthiophen-2-yl)ethylamino]pyrazole-4-carbothioamide (PubChem CID 55242496) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1,3-dimethyl-5-[1-(5-methylthiophen-2-yl)ethylamino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[1-(5-methylthiophen-2-yl)ethylamino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 55242496 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1,3-dimethyl-5-[1-(5-methylthiophen-2-yl)ethylamino]pyrazole-4-carbothioamide |
| SMILES | Cc1ccc(C(C)Nc2c(C(N)=S)c(C)nn2C)s1 |
| InChI | InChI=1S/C13H18N4S2/c1-7-5-6-10(19-7)8(2)15-13-11(12(14)18)9(3)16-17(13)4/h5-6,8,15H,1-4H3,(H2,14,18) |
| InChIKey | MVWMBCSSNFRVOR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|