C7H13N5O2 — CID 139771367
1-N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,1-diamine (PubChem CID 139771367) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,1-diamine.
| Compound Name | 1-N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 139771367 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,1-diamine |
| SMILES | Cc1nn(C)c(NC(C)N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H13N5O2/c1-4-6(12(13)14)7(9-5(2)8)11(3)10-4/h5,9H,8H2,1-3H3 |
| InChIKey | XTWREELJICVMIV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|