C9H15N5O3 — CID 54950283
2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-methylpropanamide (PubChem CID 54950283) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-methylpropanamide.
| Compound Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 54950283 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C9H15N5O3/c1-5-7(14(16)17)8(13(4)12-5)11-6(2)9(15)10-3/h6,11H,1-4H3,(H,10,15) |
| InChIKey | OGMQPOVUIGUJQK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|