About 2-ethenyl-3,6-dimethylbenzenethiol
2-ethenyl-3,6-dimethylbenzenethiol (PubChem CID 143494657) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-ethenyl-3,6-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2-ethenyl-3,6-dimethylbenzenethiol |
| PubChem CID | 143494657 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-ethenyl-3,6-dimethylbenzenethiol |
| SMILES | C=Cc1c(C)ccc(C)c1S |
| InChI | InChI=1S/C10H12S/c1-4-9-7(2)5-6-8(3)10(9)11/h4-6,11H,1H2,2-3H3 |
| InChIKey | OTXBDEDBPCRHRW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3,6-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3,6-dimethylbenzenethiol?
The IUPAC name of 2-ethenyl-3,6-dimethylbenzenethiol (CID 143494657) is 2-ethenyl-3,6-dimethylbenzenethiol.
What is the SMILES notation for 2-ethenyl-3,6-dimethylbenzenethiol?
The canonical SMILES for 2-ethenyl-3,6-dimethylbenzenethiol is C=Cc1c(C)ccc(C)c1S.
What is the InChIKey of 2-ethenyl-3,6-dimethylbenzenethiol?
The InChIKey is OTXBDEDBPCRHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S/c1-4-9-7(2)5-6-8(3)10(9)11/h4-6,11H,1H2,2-3H3.
What are the key properties of 2-ethenyl-3,6-dimethylbenzenethiol?
2-ethenyl-3,6-dimethylbenzenethiol has a molecular weight of 164.27 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3,6-dimethylbenzenethiol is sourced from PubChem (CID 143494657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).