C10H12S — CID 143494657
2-ethenyl-3,6-dimethylbenzenethiol (PubChem CID 143494657) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-ethenyl-3,6-dimethylbenzenethiol.
| Compound Name | 2-ethenyl-3,6-dimethylbenzenethiol |
|---|---|
| PubChem CID | 143494657 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-ethenyl-3,6-dimethylbenzenethiol |
| SMILES | C=Cc1c(C)ccc(C)c1S |
| InChI | InChI=1S/C10H12S/c1-4-9-7(2)5-6-8(3)10(9)11/h4-6,11H,1H2,2-3H3 |
| InChIKey | OTXBDEDBPCRHRW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|