C10H10O — CID 18541843
2,4-bis(ethenyl)phenol (PubChem CID 18541843) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,4-bis(ethenyl)phenol.
| Compound Name | 2,4-bis(ethenyl)phenol |
|---|---|
| PubChem CID | 18541843 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2,4-bis(ethenyl)phenol |
| SMILES | C=Cc1ccc(O)c(C=C)c1 |
| InChI | InChI=1S/C10H10O/c1-3-8-5-6-10(11)9(4-2)7-8/h3-7,11H,1-2H2 |
| InChIKey | GZGSEMRMKBBQGA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |