C10H9Cl3O4 — CID 175435134
4-ethenylbenzene-1,2-diol;2,2,2-trichloroacetic acid (PubChem CID 175435134) has the molecular formula C10H9Cl3O4 and a molecular weight of 299.54 g/mol. Its IUPAC name is 4-ethenylbenzene-1,2-diol;2,2,2-trichloroacetic acid.
| Compound Name | 4-ethenylbenzene-1,2-diol;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 175435134 |
| Molecular Formula | C10H9Cl3O4 |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 4-ethenylbenzene-1,2-diol;2,2,2-trichloroacetic acid |
| SMILES | C=Cc1ccc(O)c(O)c1.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H8O2.C2HCl3O2/c1-2-6-3-4-7(9)8(10)5-6;3-2(4,5)1(6)7/h2-5,9-10H,1H2;(H,6,7) |
| InChIKey | DUEBVVCKVDLCPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|