About 4-ethenylphthalic acid
4-ethenylphthalic acid (PubChem CID 90982643) has the molecular formula C20H16O8
and a molecular weight of 384.34 g/mol. Its IUPAC name is 4-ethenylphthalic acid.
Molecular Properties
| Compound Name | 4-ethenylphthalic acid |
| PubChem CID | 90982643 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-ethenylphthalic acid |
| SMILES | C=Cc1ccc(C(=O)O)c(C(=O)O)c1.C=Cc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/2C10H8O4/c2*1-2-6-3-4-7(9(11)12)8(5-6)10(13)14/h2*2-5H,1H2,(H,11,12)(H,13,14) |
| InChIKey | CFZACZXBFFXTDG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethenylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphthalic acid?
The IUPAC name of 4-ethenylphthalic acid (CID 90982643) is 4-ethenylphthalic acid.
What is the SMILES notation for 4-ethenylphthalic acid?
The canonical SMILES for 4-ethenylphthalic acid is C=Cc1ccc(C(=O)O)c(C(=O)O)c1.C=Cc1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-ethenylphthalic acid?
The InChIKey is CFZACZXBFFXTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H8O4/c2*1-2-6-3-4-7(9(11)12)8(5-6)10(13)14/h2*2-5H,1H2,(H,11,12)(H,13,14).
What are the key properties of 4-ethenylphthalic acid?
4-ethenylphthalic acid has a molecular weight of 384.34 g/mol, XLogP of 3.45, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphthalic acid is sourced from PubChem (CID 90982643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).