C15H19NO — CID 142190081
2-methanimidoyl-4-(2-methylidenebut-3-enyl)phenol;prop-1-ene (PubChem CID 142190081) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-methanimidoyl-4-(2-methylidenebut-3-enyl)phenol;prop-1-ene.
| Compound Name | 2-methanimidoyl-4-(2-methylidenebut-3-enyl)phenol;prop-1-ene |
|---|---|
| PubChem CID | 142190081 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-methanimidoyl-4-(2-methylidenebut-3-enyl)phenol;prop-1-ene |
| SMILES | C=CC.[H]/N=C/c1cc(CC(=C)C=C)ccc1O |
| InChI | InChI=1S/C12H13NO.C3H6/c1-3-9(2)6-10-4-5-12(14)11(7-10)8-13;1-3-2/h3-5,7-8,13-14H,1-2,6H2;3H,1H2,2H3/b13-8+; |
| InChIKey | PVGFKADUDMBGMW-FNXZNAJJSA-N |
| XLogP | 3.87 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|