C12H16N3O2+ — CID 143853294
[(Z)-2-aminoethenyl]-[(4-hydroxy-3-methanimidoylphenyl)methoxymethylidene]-methylazanium (PubChem CID 143853294) has the molecular formula C12H16N3O2+ and a molecular weight of 234.28 g/mol. Its IUPAC name is [(Z)-2-aminoethenyl]-[(4-hydroxy-3-methanimidoylphenyl)methoxymethylidene]-methylazanium.
| Compound Name | [(Z)-2-aminoethenyl]-[(4-hydroxy-3-methanimidoylphenyl)methoxymethylidene]-methylazanium |
|---|---|
| PubChem CID | 143853294 |
| Molecular Formula | C12H16N3O2+ |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [(Z)-2-aminoethenyl]-[(4-hydroxy-3-methanimidoylphenyl)methoxymethylidene]-methylazanium |
| SMILES | [H]/N=C/c1cc(CO/C=[N+](C)/C=C\N)ccc1O |
| InChI | InChI=1S/C12H15N3O2/c1-15(5-4-13)9-17-8-10-2-3-12(16)11(6-10)7-14/h2-7,9H,8,13H2,1H3,(H-,14,16)/p+1/b5-4-,15-9+ |
| InChIKey | UYHLOFLNWKEVDR-PFKVQKCNSA-O |
| XLogP | 1.01 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|