C16H14N2O2 — CID 175330263
1-diazenyl-2-ethylanthracene-9,10-diol (PubChem CID 175330263) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-diazenyl-2-ethylanthracene-9,10-diol.
| Compound Name | 1-diazenyl-2-ethylanthracene-9,10-diol |
|---|---|
| PubChem CID | 175330263 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-diazenyl-2-ethylanthracene-9,10-diol |
| SMILES | [H]/N=N/c1c(CC)ccc2c(O)c3ccccc3c(O)c12 |
| InChI | InChI=1S/C16H14N2O2/c1-2-9-7-8-12-13(14(9)18-17)16(20)11-6-4-3-5-10(11)15(12)19/h3-8,17,19-20H,2H2,1H3/b18-17+ |
| InChIKey | GPJHUTLSTXWYGN-ISLYRVAYSA-N |
| XLogP | 4.63 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|