C14H8N2O2 — CID 136503832
anthra[1,2-c]diazete-5,10-diol (PubChem CID 136503832) has the molecular formula C14H8N2O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is anthra[1,2-c]diazete-5,10-diol.
| Compound Name | anthra[1,2-c]diazete-5,10-diol |
|---|---|
| PubChem CID | 136503832 |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | anthra[1,2-c]diazete-5,10-diol |
| SMILES | Oc1c2ccccc2c(O)c2c3c(ccc12)N=N3 |
| InChI | InChI=1S/C14H8N2O2/c17-13-7-3-1-2-4-8(7)14(18)11-9(13)5-6-10-12(11)16-15-10/h1-6,17-18H |
| InChIKey | DYNNMWLWXOPIBW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|