C16H10N2O — CID 137183911
8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),2,4,6,8,10(18),11,13,15-nonaen-17-ol (PubChem CID 137183911) has the molecular formula C16H10N2O and a molecular weight of 246.27 g/mol. Its IUPAC name is 8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),2,4,6,8,10(18),11,13,15-nonaen-17-ol.
| Compound Name | 8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),2,4,6,8,10(18),11,13,15-nonaen-17-ol |
|---|---|
| PubChem CID | 137183911 |
| Molecular Formula | C16H10N2O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),2,4,6,8,10(18),11,13,15-nonaen-17-ol |
| SMILES | Oc1c2ccccc2c2c3c(cccc13)C=CN=N2 |
| InChI | InChI=1S/C16H10N2O/c19-16-12-6-2-1-5-11(12)15-14-10(8-9-17-18-15)4-3-7-13(14)16/h1-9,19H |
| InChIKey | HWCRJNIJUZIJIJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|