C38H26N2O2 — CID 87325787
(10Z)-5,6-diphenoxy-3,4-diphenyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene (PubChem CID 87325787) has the molecular formula C38H26N2O2 and a molecular weight of 542.64 g/mol. Its IUPAC name is (10Z)-5,6-diphenoxy-3,4-diphenyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene.
| Compound Name | (10Z)-5,6-diphenoxy-3,4-diphenyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene |
|---|---|
| PubChem CID | 87325787 |
| Molecular Formula | C38H26N2O2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | (10Z)-5,6-diphenoxy-3,4-diphenyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene |
| SMILES | C1=C\c2ccccc2-c2c(c(Oc3ccccc3)c(Oc3ccccc3)c(-c3ccccc3)c2-c2ccccc2)\N=N/1 |
| InChI | InChI=1S/C38H26N2O2/c1-5-16-28(17-6-1)33-34(29-18-7-2-8-19-29)37(41-30-20-9-3-10-21-30)38(42-31-22-11-4-12-23-31)36-35(33)32-24-14-13-15-27(32)25-26-39-40-36/h1-26H/b26-25-,27-25-,35-32-,39-26-,40-36+,40-39- |
| InChIKey | OSEVUGORILSJGU-BMSFWAGSSA-N |
| XLogP | 11.34 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |