C14H14N2 — CID 70139204
8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),8,10,12,14-hexaene (PubChem CID 70139204) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),8,10,12,14-hexaene.
| Compound Name | 8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),8,10,12,14-hexaene |
|---|---|
| PubChem CID | 70139204 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),8,10,12,14-hexaene |
| SMILES | C1=Cc2ccccc2C2=C(CCCC2)/N=N\1 |
| InChI | InChI=1S/C14H14N2/c1-2-6-12-11(5-1)9-10-15-16-14-8-4-3-7-13(12)14/h1-2,5-6,9-10H,3-4,7-8H2/b10-9?,11-9?,13-12-,15-10?,16-14-,16-15- |
| InChIKey | PTPAIYCSLAFYRV-CYRFYMJWSA-N |
| XLogP | 4.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |