C10H6N2 — CID 54377699
naphtho[1,2-c]diazete (PubChem CID 54377699) has the molecular formula C10H6N2 and a molecular weight of 154.17 g/mol. Its IUPAC name is naphtho[1,2-c]diazete.
| Compound Name | naphtho[1,2-c]diazete |
|---|---|
| PubChem CID | 54377699 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | naphtho[1,2-c]diazete |
| SMILES | c1ccc2c3c(ccc2c1)N=N3 |
| InChI | InChI=1S/C10H6N2/c1-2-4-8-7(3-1)5-6-9-10(8)12-11-9/h1-6H |
| InChIKey | ZJHYHLMECRPBNI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |