About naphtho[2,1-b]azete
naphtho[2,1-b]azete (PubChem CID 66777316) has the molecular formula C11H7N
and a molecular weight of 153.18 g/mol. Its IUPAC name is naphtho[2,1-b]azete.
Molecular Properties
| Compound Name | naphtho[2,1-b]azete |
| PubChem CID | 66777316 |
| Molecular Formula | C11H7N |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | naphtho[2,1-b]azete |
| SMILES | C1=Nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H7N/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-11/h1-7H |
| InChIKey | LDFDNXLENXFOSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphtho[2,1-b]azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,1-b]azete?
The IUPAC name of naphtho[2,1-b]azete (CID 66777316) is naphtho[2,1-b]azete.
What is the SMILES notation for naphtho[2,1-b]azete?
The canonical SMILES for naphtho[2,1-b]azete is C1=Nc2ccc3ccccc3c21.
What is the InChIKey of naphtho[2,1-b]azete?
The InChIKey is LDFDNXLENXFOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-11/h1-7H.
What are the key properties of naphtho[2,1-b]azete?
naphtho[2,1-b]azete has a molecular weight of 153.18 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,1-b]azete is sourced from PubChem (CID 66777316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).