C11H7N — CID 66777316
naphtho[2,1-b]azete (PubChem CID 66777316) has the molecular formula C11H7N and a molecular weight of 153.18 g/mol. Its IUPAC name is naphtho[2,1-b]azete.
| Compound Name | naphtho[2,1-b]azete |
|---|---|
| PubChem CID | 66777316 |
| Molecular Formula | C11H7N |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | naphtho[2,1-b]azete |
| SMILES | C1=Nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H7N/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-11/h1-7H |
| InChIKey | LDFDNXLENXFOSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |