C16H10N2O4S — CID 141310897
2-(2-hydroxynaphthalen-1-yl)-6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraene-8-sulfonic acid (PubChem CID 141310897) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-(2-hydroxynaphthalen-1-yl)-6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraene-8-sulfonic acid.
| Compound Name | 2-(2-hydroxynaphthalen-1-yl)-6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraene-8-sulfonic acid |
|---|---|
| PubChem CID | 141310897 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(2-hydroxynaphthalen-1-yl)-6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraene-8-sulfonic acid |
| SMILES | O=S(=O)(O)c1c2ccc(-c3c(O)ccc4ccccc34)c1N=N2 |
| InChI | InChI=1S/C16H10N2O4S/c19-13-8-5-9-3-1-2-4-10(9)14(13)11-6-7-12-16(23(20,21)22)15(11)18-17-12/h1-8,19H,(H,20,21,22) |
| InChIKey | ZHWVWRMBPVUKNB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|