C6H4N2O4S — CID 141403492
3-hydroxy-7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraene-2-sulfonic acid (PubChem CID 141403492) has the molecular formula C6H4N2O4S and a molecular weight of 200.18 g/mol. Its IUPAC name is 3-hydroxy-7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraene-2-sulfonic acid.
| Compound Name | 3-hydroxy-7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraene-2-sulfonic acid |
|---|---|
| PubChem CID | 141403492 |
| Molecular Formula | C6H4N2O4S |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 3-hydroxy-7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(O)ccc2c1N=N2 |
| InChI | InChI=1S/C6H4N2O4S/c9-4-2-1-3-5(8-7-3)6(4)13(10,11)12/h1-2,9H,(H,10,11,12) |
| InChIKey | DVWYEAVWSYYKLC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|