C8H10O4S — CID 130033370
2-methyl-3-methylsulfonylbenzene-1,4-diol (PubChem CID 130033370) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-methyl-3-methylsulfonylbenzene-1,4-diol.
| Compound Name | 2-methyl-3-methylsulfonylbenzene-1,4-diol |
|---|---|
| PubChem CID | 130033370 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-methyl-3-methylsulfonylbenzene-1,4-diol |
| SMILES | Cc1c(O)ccc(O)c1S(C)(=O)=O |
| InChI | InChI=1S/C8H10O4S/c1-5-6(9)3-4-7(10)8(5)13(2,11)12/h3-4,9-10H,1-2H3 |
| InChIKey | NLGAYCCTNGSZEP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|