C8H9AlO4S- — CID 6366018
CID 6366018 (PubChem CID 6366018) has the molecular formula C8H9AlO4S- and a molecular weight of 228.20 g/mol.
| Compound Name | CID 6366018 |
|---|---|
| PubChem CID | 6366018 |
| Molecular Formula | C8H9AlO4S- |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | — |
| SMILES | Cc1c(O)ccc(S(=O)(=O)[O-])c1C.[Al] |
| InChI | InChI=1S/C8H10O4S.Al/c1-5-6(2)8(13(10,11)12)4-3-7(5)9;/h3-4,9H,1-2H3,(H,10,11,12);/p-1 |
| InChIKey | DTMVCTMNJOBYGD-UHFFFAOYSA-M |
| XLogP | 0.53 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|