About disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate
disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate (PubChem CID 118522856) has the molecular formula C7H6Na2O7S2
and a molecular weight of 312.23 g/mol. Its IUPAC name is disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate.
Molecular Properties
| Compound Name | disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate |
| PubChem CID | 118522856 |
| Molecular Formula | C7H6Na2O7S2 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate |
| SMILES | Cc1c(S(=O)(=O)[O-])ccc(S(=O)(=O)[O-])c1O.[Na+].[Na+] |
| InChI | InChI=1S/C7H8O7S2.2Na/c1-4-5(15(9,10)11)2-3-6(7(4)8)16(12,13)14;;/h2-3,8H,1H3,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | PCPBUUPOABIWPO-UHFFFAOYSA-L |
| XLogP | -6.48 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate?
The IUPAC name of disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate (CID 118522856) is disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate.
What is the SMILES notation for disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate?
The canonical SMILES for disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate is Cc1c(S(=O)(=O)[O-])ccc(S(=O)(=O)[O-])c1O.[Na+].[Na+].
What is the InChIKey of disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate?
The InChIKey is PCPBUUPOABIWPO-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8O7S2.2Na/c1-4-5(15(9,10)11)2-3-6(7(4)8)16(12,13)14;;/h2-3,8H,1H3,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2.
What are the key properties of disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate?
disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate has a molecular weight of 312.23 g/mol, XLogP of -6.48, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-hydroxy-3-methylbenzene-1,4-disulfonate is sourced from PubChem (CID 118522856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).