C12H10O8S2 — CID 20976839
3-hydroxy-6-(4-hydroxyphenyl)benzene-1,2-disulfonic acid (PubChem CID 20976839) has the molecular formula C12H10O8S2 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-hydroxy-6-(4-hydroxyphenyl)benzene-1,2-disulfonic acid.
| Compound Name | 3-hydroxy-6-(4-hydroxyphenyl)benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 20976839 |
| Molecular Formula | C12H10O8S2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 3-hydroxy-6-(4-hydroxyphenyl)benzene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)c1c(O)ccc(-c2ccc(O)cc2)c1S(=O)(=O)O |
| InChI | InChI=1S/C12H10O8S2/c13-8-3-1-7(2-4-8)9-5-6-10(14)12(22(18,19)20)11(9)21(15,16)17/h1-6,13-14H,(H,15,16,17)(H,18,19,20) |
| InChIKey | TXGWHTRUNDLURG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|