C24H14O4 — CID 174915841
5,6-bis(4-hydroxyphenyl)acenaphthylene-1,2-dione (PubChem CID 174915841) has the molecular formula C24H14O4 and a molecular weight of 366.37 g/mol. Its IUPAC name is 5,6-bis(4-hydroxyphenyl)acenaphthylene-1,2-dione.
| Compound Name | 5,6-bis(4-hydroxyphenyl)acenaphthylene-1,2-dione |
|---|---|
| PubChem CID | 174915841 |
| Molecular Formula | C24H14O4 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5,6-bis(4-hydroxyphenyl)acenaphthylene-1,2-dione |
| SMILES | O=C1C(=O)c2ccc(-c3ccc(O)cc3)c3c(-c4ccc(O)cc4)ccc1c23 |
| InChI | InChI=1S/C24H14O4/c25-15-5-1-13(2-6-15)17-9-11-19-22-20(24(28)23(19)27)12-10-18(21(17)22)14-3-7-16(26)8-4-14/h1-12,25-26H |
| InChIKey | IWDNKUVEBOHURP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|