C22H14N4O4 — CID 136912084
2-[3,5-bis(4-hydroxyphenyl)-1,2,4-triazol-4-yl]isoindole-1,3-dione (PubChem CID 136912084) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[3,5-bis(4-hydroxyphenyl)-1,2,4-triazol-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[3,5-bis(4-hydroxyphenyl)-1,2,4-triazol-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 136912084 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[3,5-bis(4-hydroxyphenyl)-1,2,4-triazol-4-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1n1c(-c2ccc(O)cc2)nnc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C22H14N4O4/c27-15-9-5-13(6-10-15)19-23-24-20(14-7-11-16(28)12-8-14)25(19)26-21(29)17-3-1-2-4-18(17)22(26)30/h1-12,27-28H |
| InChIKey | KHIJRSKGFYHJEQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|