C18H16N4O — CID 135427920
4-[4-methyl-5-(1-methylindol-4-yl)-1,2,4-triazol-3-yl]phenol (PubChem CID 135427920) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[4-methyl-5-(1-methylindol-4-yl)-1,2,4-triazol-3-yl]phenol.
| Compound Name | 4-[4-methyl-5-(1-methylindol-4-yl)-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 135427920 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[4-methyl-5-(1-methylindol-4-yl)-1,2,4-triazol-3-yl]phenol |
| SMILES | Cn1c(-c2ccc(O)cc2)nnc1-c1cccc2c1ccn2C |
| InChI | InChI=1S/C18H16N4O/c1-21-11-10-14-15(4-3-5-16(14)21)18-20-19-17(22(18)2)12-6-8-13(23)9-7-12/h3-11,23H,1-2H3 |
| InChIKey | OUQNCJWPBUSXPR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |