C18H14N2O — CID 135727095
4-(3-methylbenzo[e]benzimidazol-2-yl)phenol (PubChem CID 135727095) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(3-methylbenzo[e]benzimidazol-2-yl)phenol.
| Compound Name | 4-(3-methylbenzo[e]benzimidazol-2-yl)phenol |
|---|---|
| PubChem CID | 135727095 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(3-methylbenzo[e]benzimidazol-2-yl)phenol |
| SMILES | Cn1c(-c2ccc(O)cc2)nc2c3ccccc3ccc21 |
| InChI | InChI=1S/C18H14N2O/c1-20-16-11-8-12-4-2-3-5-15(12)17(16)19-18(20)13-6-9-14(21)10-7-13/h2-11,21H,1H3 |
| InChIKey | CLFQBYACSGWEOG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |