C18H13O5S- — CID 176583554
2,6-bis(4-hydroxyphenyl)benzenesulfonate (PubChem CID 176583554) has the molecular formula C18H13O5S- and a molecular weight of 341.36 g/mol. Its IUPAC name is 2,6-bis(4-hydroxyphenyl)benzenesulfonate.
| Compound Name | 2,6-bis(4-hydroxyphenyl)benzenesulfonate |
|---|---|
| PubChem CID | 176583554 |
| Molecular Formula | C18H13O5S- |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2,6-bis(4-hydroxyphenyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(-c2ccc(O)cc2)cccc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C18H14O5S/c19-14-8-4-12(5-9-14)16-2-1-3-17(18(16)24(21,22)23)13-6-10-15(20)11-7-13/h1-11,19-20H,(H,21,22,23)/p-1 |
| InChIKey | KGBAPAPKIBHXHI-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|