C16H14N2O2 — CID 123973676
1,2,3,4-tetrahydronaphtho[3,2-f]quinoxaline-7,12-diol (PubChem CID 123973676) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphtho[3,2-f]quinoxaline-7,12-diol.
| Compound Name | 1,2,3,4-tetrahydronaphtho[3,2-f]quinoxaline-7,12-diol |
|---|---|
| PubChem CID | 123973676 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,2,3,4-tetrahydronaphtho[3,2-f]quinoxaline-7,12-diol |
| SMILES | Oc1c2ccccc2c(O)c2c3c(ccc12)NCCN3 |
| InChI | InChI=1S/C16H14N2O2/c19-15-9-3-1-2-4-10(9)16(20)13-11(15)5-6-12-14(13)18-8-7-17-12/h1-6,17-20H,7-8H2 |
| InChIKey | ZAIRZONQTQZGSD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|