C15H13FN2O — CID 57287537
(2-fluorophenyl)-(1,2,3,4-tetrahydroquinoxalin-5-yl)methanone (PubChem CID 57287537) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is (2-fluorophenyl)-(1,2,3,4-tetrahydroquinoxalin-5-yl)methanone.
| Compound Name | (2-fluorophenyl)-(1,2,3,4-tetrahydroquinoxalin-5-yl)methanone |
|---|---|
| PubChem CID | 57287537 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2-fluorophenyl)-(1,2,3,4-tetrahydroquinoxalin-5-yl)methanone |
| SMILES | O=C(c1ccccc1F)c1cccc2c1NCCN2 |
| InChI | InChI=1S/C15H13FN2O/c16-12-6-2-1-4-10(12)15(19)11-5-3-7-13-14(11)18-9-8-17-13/h1-7,17-18H,8-9H2 |
| InChIKey | AXPNLSFFZGMODW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|