C17H19N3O — CID 104614392
N-(1-phenylethyl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide (PubChem CID 104614392) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(1-phenylethyl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide.
| Compound Name | N-(1-phenylethyl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104614392 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(1-phenylethyl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
| SMILES | CC(NC(=O)c1cccc2c1NCCN2)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O/c1-12(13-6-3-2-4-7-13)20-17(21)14-8-5-9-15-16(14)19-11-10-18-15/h2-9,12,18-19H,10-11H2,1H3,(H,20,21) |
| InChIKey | IGHFENKOWJKNFQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |