C18H14N2O3 — CID 136510379
spiro[naphtho[3,2-e]benzimidazole-2,3'-oxolane]-6,11-diol (PubChem CID 136510379) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is spiro[naphtho[3,2-e]benzimidazole-2,3'-oxolane]-6,11-diol.
| Compound Name | spiro[naphtho[3,2-e]benzimidazole-2,3'-oxolane]-6,11-diol |
|---|---|
| PubChem CID | 136510379 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | spiro[naphtho[3,2-e]benzimidazole-2,3'-oxolane]-6,11-diol |
| SMILES | Oc1c2ccccc2c(O)c2c3c(ccc12)=NC1(CCOC1)N=3 |
| InChI | InChI=1S/C18H14N2O3/c21-16-10-3-1-2-4-11(10)17(22)14-12(16)5-6-13-15(14)20-18(19-13)7-8-23-9-18/h1-6,21-22H,7-9H2 |
| InChIKey | LZJYCWMOZIEVLN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|