C14H12N2O2 — CID 6687
1,4-diimino-2,3-dihydroanthracene-9,10-diol (PubChem CID 6687) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1,4-diimino-2,3-dihydroanthracene-9,10-diol.
| Compound Name | 1,4-diimino-2,3-dihydroanthracene-9,10-diol |
|---|---|
| PubChem CID | 6687 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,4-diimino-2,3-dihydroanthracene-9,10-diol |
| SMILES | [H]/N=C1\CC/C(=N\[H])c2c1c(O)c1ccccc1c2O |
| InChI | InChI=1S/C14H12N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4,15-18H,5-6H2/b15-9+,16-10+ |
| InChIKey | UFVDYITXJBCPMW-KAVGSWPWSA-N |
| XLogP | 2.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|