C14H11NO2 — CID 135407253
9-imino-10H-anthracene-1,8-diol (PubChem CID 135407253) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 9-imino-10H-anthracene-1,8-diol.
| Compound Name | 9-imino-10H-anthracene-1,8-diol |
|---|---|
| PubChem CID | 135407253 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 9-imino-10H-anthracene-1,8-diol |
| SMILES | [H]N=C1c2c(O)cccc2Cc2cccc(O)c21 |
| InChI | InChI=1S/C14H11NO2/c15-14-12-8(3-1-5-10(12)16)7-9-4-2-6-11(17)13(9)14/h1-6,15-17H,7H2 |
| InChIKey | PSXQHDJVYHURTR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|