C14H6N2O6S2 — CID 616527
9,18-dioxa-10lambda6,17lambda6-dithia-11,16-diazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),11,13,15-octaene 10,10,17,17-tetraoxide (PubChem CID 616527) has the molecular formula C14H6N2O6S2 and a molecular weight of 362.34 g/mol. Its IUPAC name is 9,18-dioxa-10lambda6,17lambda6-dithia-11,16-diazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),11,13,15-octaene 10,10,17,17-tetraoxide.
| Compound Name | 9,18-dioxa-10lambda6,17lambda6-dithia-11,16-diazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),11,13,15-octaene 10,10,17,17-tetraoxide |
|---|---|
| PubChem CID | 616527 |
| Molecular Formula | C14H6N2O6S2 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 9,18-dioxa-10lambda6,17lambda6-dithia-11,16-diazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),11,13,15-octaene 10,10,17,17-tetraoxide |
| SMILES | O=S1(=O)N=c2ccc3c4c(c5ccccc5c(c24)O1)OS(=O)(=O)N=3 |
| InChI | InChI=1S/C14H6N2O6S2/c17-23(18)15-9-5-6-10-12-11(9)13(21-23)7-3-1-2-4-8(7)14(12)22-24(19,20)16-10/h1-6H |
| InChIKey | UETSSTUCMYSOAS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|