C30H21NO6 — CID 140543975
7-(2,6-diethylphenyl)-14,21-dihydroxy-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5(9),10,13,15,17,19-octaene-2,6,8,12-tetrone (PubChem CID 140543975) has the molecular formula C30H21NO6 and a molecular weight of 491.50 g/mol. Its IUPAC name is 7-(2,6-diethylphenyl)-14,21-dihydroxy-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5(9),10,13,15,17,19-octaene-2,6,8,12-tetrone.
| Compound Name | 7-(2,6-diethylphenyl)-14,21-dihydroxy-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5(9),10,13,15,17,19-octaene-2,6,8,12-tetrone |
|---|---|
| PubChem CID | 140543975 |
| Molecular Formula | C30H21NO6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 7-(2,6-diethylphenyl)-14,21-dihydroxy-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5(9),10,13,15,17,19-octaene-2,6,8,12-tetrone |
| SMILES | CCc1cccc(CC)c1-n1c(=O)c2cc3c(=O)c4c(O)c5ccccc5c(O)c4c(=O)c3cc2c1=O |
| InChI | InChI=1S/C30H21NO6/c1-3-14-8-7-9-15(4-2)24(14)31-29(36)20-12-18-19(13-21(20)30(31)37)28(35)23-22(27(18)34)25(32)16-10-5-6-11-17(16)26(23)33/h5-13,32-33H,3-4H2,1-2H3 |
| InChIKey | IOOYNIQJVZEKQZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|