C22H36 — CID 139617866
1-but-2-enyl-2,3,4-tributylbenzene (PubChem CID 139617866) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1-but-2-enyl-2,3,4-tributylbenzene.
| Compound Name | 1-but-2-enyl-2,3,4-tributylbenzene |
|---|---|
| PubChem CID | 139617866 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1-but-2-enyl-2,3,4-tributylbenzene |
| SMILES | CC=CCc1ccc(CCCC)c(CCCC)c1CCCC |
| InChI | InChI=1S/C22H36/c1-5-9-13-19-17-18-20(14-10-6-2)22(16-12-8-4)21(19)15-11-7-3/h5,9,17-18H,6-8,10-16H2,1-4H3 |
| InChIKey | QEXPGQRXSQHIHR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|