C25H36O3 — CID 174882244
2,3-dibutyl-6-methylphenol;2-methoxy-4-prop-2-enylphenol (PubChem CID 174882244) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2,3-dibutyl-6-methylphenol;2-methoxy-4-prop-2-enylphenol.
| Compound Name | 2,3-dibutyl-6-methylphenol;2-methoxy-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 174882244 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2,3-dibutyl-6-methylphenol;2-methoxy-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(OC)c1.CCCCc1ccc(C)c(O)c1CCCC |
| InChI | InChI=1S/C15H24O.C10H12O2/c1-4-6-8-13-11-10-12(3)15(16)14(13)9-7-5-2;1-3-4-8-5-6-9(11)10(7-8)12-2/h10-11,16H,4-9H2,1-3H3;3,5-7,11H,1,4H2,2H3 |
| InChIKey | DEYKAHYBHLACAU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|