C27H50O3P+ — CID 172806364
(3,4-didecyl-2-methylphenyl)-trihydroxyphosphanium (PubChem CID 172806364) has the molecular formula C27H50O3P+ and a molecular weight of 453.67 g/mol. Its IUPAC name is (3,4-didecyl-2-methylphenyl)-trihydroxyphosphanium.
| Compound Name | (3,4-didecyl-2-methylphenyl)-trihydroxyphosphanium |
|---|---|
| PubChem CID | 172806364 |
| Molecular Formula | C27H50O3P+ |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.35 |
| IUPAC Name | (3,4-didecyl-2-methylphenyl)-trihydroxyphosphanium |
| SMILES | CCCCCCCCCCc1ccc([P+](O)(O)O)c(C)c1CCCCCCCCCC |
| InChI | InChI=1S/C27H50O3P/c1-4-6-8-10-12-14-16-18-20-25-22-23-27(31(28,29)30)24(3)26(25)21-19-17-15-13-11-9-7-5-2/h22-23,28-30H,4-21H2,1-3H3/q+1 |
| InChIKey | DBDGFOUWRUULDG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|