C20H30O4 — CID 139838897
4-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]-4-oxobutanoic acid (PubChem CID 139838897) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139838897 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]-4-oxobutanoic acid |
| SMILES | CCC(C)(C)c1cc(C(=O)CCC(=O)O)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C20H30O4/c1-7-19(3,4)14-11-13(16(21)9-10-17(22)23)12-15(18(14)24)20(5,6)8-2/h11-12,24H,7-10H2,1-6H3,(H,22,23) |
| InChIKey | AOOOPNVPSPEFSE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |