C68H112O6 — CID 158648417
(E)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-17-(oxiran-2-yl)heptadec-10-en-1-one;1-(3,5-ditert-butyl-4-hydroxyphenyl)undec-10-en-1-one;2-oct-7-enyloxirane (PubChem CID 158648417) has the molecular formula C68H112O6 and a molecular weight of 1025.64 g/mol. Its IUPAC name is (E)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-17-(oxiran-2-yl)heptadec-10-en-1-one;1-(3,5-ditert-butyl-4-hydroxyphenyl)undec-10-en-1-one;2-oct-7-enyloxirane.
| Compound Name | (E)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-17-(oxiran-2-yl)heptadec-10-en-1-one;1-(3,5-ditert-butyl-4-hydroxyphenyl)undec-10-en-1-one;2-oct-7-enyloxirane |
|---|---|
| PubChem CID | 158648417 |
| Molecular Formula | C68H112O6 |
| Molecular Weight | 1025.64 g/mol |
| Exact Mass | 1024.85 |
| IUPAC Name | (E)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-17-(oxiran-2-yl)heptadec-10-en-1-one;1-(3,5-ditert-butyl-4-hydroxyphenyl)undec-10-en-1-one;2-oct-7-enyloxirane |
| SMILES | C=CCCCCCCC1CO1.C=CCCCCCCCCC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(C(=O)CCCCCCCC/C=C/CCCCCCC2CO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H54O3.C25H40O2.C10H18O/c1-32(2,3)28-23-26(24-29(31(28)35)33(4,5)6)30(34)22-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-27-25-36-27;1-8-9-10-11-12-13-14-15-16-22(26)19-17-20(24(2,3)4)23(27)21(18-19)25(5,6)7;1-2-3-4-5-6-7-8-10-9-11-10/h7,9,23-24,27,35H,8,10-22,25H2,1-6H3;8,17-18,27H,1,9-16H2,2-7H3;2,10H,1,3-9H2/b9-7+;; |
| InChIKey | IBGINZVXUIQAEW-OJYIHNBOSA-N |
| XLogP | 19.97 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.64 |
| LogP ≤ 5 | 19.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|