C21H28N2O5 — CID 57301834
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2,5-dioxopyrrol-1-yl)-N-hydroxypropanamide (PubChem CID 57301834) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2,5-dioxopyrrol-1-yl)-N-hydroxypropanamide.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2,5-dioxopyrrol-1-yl)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 57301834 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2,5-dioxopyrrol-1-yl)-N-hydroxypropanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)N(O)N2C(=O)C=CC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H28N2O5/c1-20(2,3)14-11-13(12-15(19(14)27)21(4,5)6)7-8-18(26)23(28)22-16(24)9-10-17(22)25/h9-12,27-28H,7-8H2,1-6H3 |
| InChIKey | VTSILSRULITDRN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|