C34H58CaO8P2 — CID 87899271
CID 87899271 (PubChem CID 87899271) has the molecular formula C34H58CaO8P2 and a molecular weight of 696.86 g/mol.
| Compound Name | CID 87899271 |
|---|---|
| PubChem CID | 87899271 |
| Molecular Formula | C34H58CaO8P2 |
| Molecular Weight | 696.86 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | — |
| SMILES | CCc1c(C(C)(C)C)cc(C(O)P(=O)(O)O)cc1C(C)(C)C.CCc1c(C(C)(C)C)cc(C(O)P(=O)(O)O)cc1C(C)(C)C.[Ca] |
| InChI | InChI=1S/2C17H29O4P.Ca/c2*1-8-12-13(16(2,3)4)9-11(15(18)22(19,20)21)10-14(12)17(5,6)7;/h2*9-10,15,18H,8H2,1-7H3,(H2,19,20,21); |
| InChIKey | PAFWWYXNBIMJCS-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.86 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|