C14H22O — CID 123284303
(2-tert-butyl-6-ethyl-4-methylphenyl)methanol (PubChem CID 123284303) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (2-tert-butyl-6-ethyl-4-methylphenyl)methanol.
| Compound Name | (2-tert-butyl-6-ethyl-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 123284303 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2-tert-butyl-6-ethyl-4-methylphenyl)methanol |
| SMILES | CCc1cc(C)cc(C(C)(C)C)c1CO |
| InChI | InChI=1S/C14H22O/c1-6-11-7-10(2)8-13(12(11)9-15)14(3,4)5/h7-8,15H,6,9H2,1-5H3 |
| InChIKey | QSOZTHRDIOPQJO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |