C15H26N2O — CID 57063776
6-tert-butyl-4-[(2,2-dimethylhydrazinyl)methyl]-2,3-dimethylphenol (PubChem CID 57063776) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 6-tert-butyl-4-[(2,2-dimethylhydrazinyl)methyl]-2,3-dimethylphenol.
| Compound Name | 6-tert-butyl-4-[(2,2-dimethylhydrazinyl)methyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 57063776 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 6-tert-butyl-4-[(2,2-dimethylhydrazinyl)methyl]-2,3-dimethylphenol |
| SMILES | Cc1c(CNN(C)C)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C15H26N2O/c1-10-11(2)14(18)13(15(3,4)5)8-12(10)9-16-17(6)7/h8,16,18H,9H2,1-7H3 |
| InChIKey | BTFWIARZDPLKRH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|