C19H26O4 — CID 170366592
6-ethyl-2,4-dihydroxy-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid (PubChem CID 170366592) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 6-ethyl-2,4-dihydroxy-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid.
| Compound Name | 6-ethyl-2,4-dihydroxy-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 170366592 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 6-ethyl-2,4-dihydroxy-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid |
| SMILES | CCc1cc(O)c(CC2=C(C)CC(C)(C)CC2)c(O)c1C(=O)O |
| InChI | InChI=1S/C19H26O4/c1-5-12-9-15(20)14(17(21)16(12)18(22)23)8-13-6-7-19(3,4)10-11(13)2/h9,20-21H,5-8,10H2,1-4H3,(H,22,23) |
| InChIKey | NUAMGUVGKKKYTN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|